EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11N4O10P2 |
| Net Charge | -3 |
| Average Mass | 409.164 |
| Monoisotopic Mass | 408.99669 |
| SMILES | O=c1ncnc2c1ncn2[C@H]1C[C@H](O)[C@@H](COP(=O)([O-])OP(=O)([O-])[O-])O1 |
| InChI | InChI=1S/C10H14N4O10P2/c15-5-1-7(14-4-13-8-9(14)11-3-12-10(8)16)23-6(5)2-22-26(20,21)24-25(17,18)19/h3-7,15H,1-2H2,(H,20,21)(H,11,12,16)(H2,17,18,19)/p-3/t5-,6+,7+/m0/s1 |
| InChIKey | BKUSIKGSPSFQAC-RRKCRQDMSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-deoxyinosine 5'-diphosphate(3−) (CHEBI:62286) is a 2'-deoxyribonucleoside 5'-diphosphate(3−) (CHEBI:73316) |
| 2'-deoxyinosine 5'-diphosphate(3−) (CHEBI:62286) is conjugate base of 2'-deoxyinosine-5'-diphosphate (CHEBI:28823) |
| Incoming Relation(s) |
| 2'-deoxyinosine-5'-diphosphate (CHEBI:28823) is conjugate acid of 2'-deoxyinosine 5'-diphosphate(3−) (CHEBI:62286) |
| IUPAC Name |
|---|
| 2'-deoxy-5'-O-[(phosphonatooxy)phosphinato]inosine |
| Synonyms | Source |
|---|---|
| deoxyinosine diphosphate(3−) | SUBMITTER |
| dIDP(3−) | ChEBI |
| deoxyinosine diphosphate | ChEBI |
| dIDP | ChEBI |
| 2'-deoxyinosine-5'-diphosphate | ChEBI |
| UniProt Name | Source |
|---|---|
| dIDP | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD0-2231 | MetaCyc |