EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H25NO10 |
| Net Charge | 0 |
| Average Mass | 367.351 |
| Monoisotopic Mass | 367.14785 |
| SMILES | CC(=O)N[C@@H]1[C@@H](O[C@@H]2O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](CO)O[C@H]1O |
| WURCS | WURCS=2.0/2,2,1/[a2122h-1b_1-5_2*NCC/3=O][a1221m-1a_1-5]/1-2/a3-b1 |
| InChI | InChI=1S/C14H25NO10/c1-4-8(18)10(20)11(21)14(23-4)25-12-7(15-5(2)17)13(22)24-6(3-16)9(12)19/h4,6-14,16,18-22H,3H2,1-2H3,(H,15,17)/t4-,6+,7+,8+,9+,10+,11-,12+,13+,14-/m0/s1 |
| InChIKey | TUXVLTYUDHJDAL-QLAGSXOSSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-L-Fucp-(1→3)-β-D-GlcpNAc (CHEBI:62276) has role epitope (CHEBI:53000) |
| α-L-Fucp-(1→3)-β-D-GlcpNAc (CHEBI:62276) is a amino disaccharide (CHEBI:22480) |
| α-L-Fucp-(1→3)-β-D-GlcpNAc (CHEBI:62276) is a glucosamine oligosaccharide (CHEBI:22485) |
| Incoming Relation(s) |
| α-L-Fucp-(1→3)-β-D-GlcpNAc-(1→2)-D-Galp (CHEBI:146731) has functional parent α-L-Fucp-(1→3)-β-D-GlcpNAc (CHEBI:62276) |
| α-L-Fucp-(1→3)-β-D-GlcpNAc-(1→2)-D-Manp (CHEBI:147017) has functional parent α-L-Fucp-(1→3)-β-D-GlcpNAc (CHEBI:62276) |
| α-L-Fucp-(1→3)-β-D-GlcpNAc-(1→6)-D-GalpNAc (CHEBI:148693) has functional parent α-L-Fucp-(1→3)-β-D-GlcpNAc (CHEBI:62276) |
| α-L-Fucp-(1→3)-β-D-GlcpNAc-(1→6)-α-D-Manp (CHEBI:147655) has functional parent α-L-Fucp-(1→3)-β-D-GlcpNAc (CHEBI:62276) |
| α-L-Fucp-(1→3)-[α-L-Fucp-(1→6)]-β-D-GlcpNAc (CHEBI:146752) has functional parent α-L-Fucp-(1→3)-β-D-GlcpNAc (CHEBI:62276) |
| IUPAC Name |
|---|
| α-L-fucopyranosyl-(1→3)-2-acetamido-2-deoxy-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| α-L-Fuc-(1→3)-β-D-GlcNAc | ChEBI |
| α-L-Fucp-(1→3)-β-D-GlcpNAc | ChEBI |
| 2-(acetylamino)-2-deoxy-3-O-(6-deoxy-α-L-galactopyranosyl)-β-D-glucopyranose | IUPAC |
| 2-(acetylamino)-2-deoxy-3-O-(α-L-fucopyranosyl)-β-D-glucopyranose | ChEBI |
| 2-acetamido-2-deoxy-3-O-(α-L-fucopyranosyl)-β-D-glucopyranose | ChEBI |
| α-L-Fuc-(1-3)-β-D-GlcNAc | ChEBI |
| Citations |
|---|