EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H34N4O2.HCl |
| Net Charge | 0 |
| Average Mass | 519.089 |
| Monoisotopic Mass | 518.24485 |
| SMILES | CCc1cc2c(cc1N1CCC(N3CCOCC3)CC1)C(C)(C)c1nc3cc(C#N)ccc3c1C2=O.Cl |
| InChI | InChI=1S/C30H34N4O2.ClH/c1-4-20-16-23-24(17-26(20)34-9-7-21(8-10-34)33-11-13-36-14-12-33)30(2,3)29-27(28(23)35)22-6-5-19(18-31)15-25(22)32-29;/h5-6,15-17,21,32H,4,7-14H2,1-3H3;1H |
| InChIKey | GYABBVHSRIHYJR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alectinib hydrochloride (CHEBI:62268) has part alectinib(1+) (CHEBI:90937) |
| alectinib hydrochloride (CHEBI:62268) has role antineoplastic agent (CHEBI:35610) |
| alectinib hydrochloride (CHEBI:62268) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| alectinib hydrochloride (CHEBI:62268) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 9-ethyl-6,6-dimethyl-8-[4-(morpholin-4-yl)piperidin-1-yl]-11-oxo-6,11-dihydro-5H-benzo[b]carbazole-3-carbonitrile hydrochloride |
| Synonyms | Source |
|---|---|
| AF-802 hydrochloride | ChemIDplus |
| alectinib monohydrochloride | ChEBI |
| CH5424802 | ChEBI |
| Brand Name | Source |
|---|---|
| Alecensa | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23594297 | Reaxys |
| CAS:1256589-74-8 | ChemIDplus |
| Citations |
|---|