EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H46O8 |
| Net Charge | 0 |
| Average Mass | 558.712 |
| Monoisotopic Mass | 558.31927 |
| SMILES | [H][C@@]12CC=C3C(C)(C)C(=O)C(O)=C[C@@]3([H])[C@]1(C)C(=O)C[C@@]1(C)[C@@]2(C)C[C@@H](O)[C@]1([H])[C@@](C)(O)C(=O)CCC(C)(C)OC(C)=O |
| InChI | InChI=1S/C32H46O8/c1-17(33)40-27(2,3)13-12-23(36)32(9,39)25-21(35)15-29(6)22-11-10-18-19(14-20(34)26(38)28(18,4)5)31(22,8)24(37)16-30(25,29)7/h10,14,19,21-22,25,34-35,39H,11-13,15-16H2,1-9H3/t19-,21-,22+,25+,29+,30-,31+,32+/m1/s1 |
| InChIKey | XZBVNQWNPRMHRH-LAMASETHSA-N |
| Roles Classification |
|---|
| Biological Role: | allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 23,24-dihydrocucurbitacin E (CHEBI:62228) is a 23,24-dihydrocucurbitacin (CHEBI:17320) |
| 23,24-dihydrocucurbitacin E (CHEBI:62228) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| (4R)-2,16α,20-trihydroxy-9β,10,14-trimethyl-1,11,22-trioxo-4,9-cyclo-9,10-secocholesta-2,5-dien-25-yl acetate |
| Synonyms | Source |
|---|---|
| 2,16α,20,25-tetrahydroxy-9-methyl-19-nor-9β,10α-lanosta-1,5-diene-3,11,22-trione 25-acetate | ChEBI |
| 25-acetyloxy-2,16α,20-trihydroxy-9β-methyl-19-nor-10α-lanosta-1,5-diene-3,11,22-trione | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7191103 | Reaxys |