EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12C[C@@H](C(=C)C)CC[C@@]1(C)CCC=C2C |
| InChI | InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h6,13-14H,1,5,7-10H2,2-4H3/t13-,14-,15+/m0/s1 |
| InChIKey | OZQAPQSEYFAMCY-SOUVJXGZSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-7-epi-α-selinene (CHEBI:62224) is a octahydronaphthalenes (CHEBI:138397) |
| (−)-7-epi-α-selinene (CHEBI:62224) is a selinene (CHEBI:49272) |
| IUPAC Name |
|---|
| (2S,4aR,8aR)-4a,8-dimethyl-2-(prop-1-en-2-yl)-1,2,3,4,4a,5,6,8a-octahydronaphthalene |
| Synonym | Source |
|---|---|
| 7βH-eudesma-3,11-diene | ChEBI |
| UniProt Name | Source |
|---|---|
| (−)-7-epi-α-selinene | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2501575 | Reaxys |
| Citations |
|---|