EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O7 |
| Net Charge | 0 |
| Average Mass | 518.691 |
| Monoisotopic Mass | 518.32435 |
| SMILES | [H][C@@]12CC=C3C(C)(C)C(=O)[C@@H](O)C[C@@]3([H])[C@]1(C)C(=O)C[C@@]1(C)[C@@]2(C)C[C@@H](O)[C@]1([H])[C@@](C)(O)C(=O)CCC(C)(C)O |
| InChI | InChI=1S/C30H46O7/c1-25(2,36)12-11-21(33)30(8,37)23-19(32)14-27(5)20-10-9-16-17(13-18(31)24(35)26(16,3)4)29(20,7)22(34)15-28(23,27)6/h9,17-20,23,31-32,36-37H,10-15H2,1-8H3/t17-,18+,19-,20+,23+,27+,28-,29+,30+/m1/s1 |
| InChIKey | ITMUUFDDBRYVNJ-VOKXYEOFSA-N |
| Roles Classification |
|---|
| Biological Role: | allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 23,24-dihydrocucurbitacin D (CHEBI:62218) is a 23,24-dihydrocucurbitacin (CHEBI:17320) |
| 23,24-dihydrocucurbitacin D (CHEBI:62218) is a secondary α-hydroxy ketone (CHEBI:2468) |
| 23,24-dihydrocucurbitacin D (CHEBI:62218) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| (2S,4R)-2,16,20,25-tetrahydroxy-9β,10,14-trimethyl-4,9-cyclo-9,10-seco-16α-cholest-5-ene-1,11,22-trione |
| Synonyms | Source |
|---|---|
| 2β,16α,20,25- tetrahydroxy-9β-methyl-19-nor-10α-lanost-5-ene-3,11,22-trione | ChEBI |
| 2β,16α,20,25-tetrahydroxy-10α-cucurbit-5-ene-3,11,22-trione | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2513994 | Reaxys |