EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5NO3 |
| Net Charge | 0 |
| Average Mass | 127.099 |
| Monoisotopic Mass | 127.02694 |
| SMILES | O=C(O)c1ccc(O)n1 |
| InChI | InChI=1S/C5H5NO3/c7-4-2-1-3(6-4)5(8)9/h1-2,6-7H,(H,8,9) |
| InChIKey | QAJSFWNJRLTBCG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxypyrrole-2-carboxylic acid (CHEBI:62212) is a pyrrolecarboxylic acid (CHEBI:26454) |
| 5-hydroxypyrrole-2-carboxylic acid (CHEBI:62212) is conjugate acid of 5-hydroxypyrrole-2-carboxylate (CHEBI:62210) |
| Incoming Relation(s) |
| 5-hydroxypyrrole-2-carboxylate (CHEBI:62210) is conjugate base of 5-hydroxypyrrole-2-carboxylic acid (CHEBI:62212) |
| IUPAC Name |
|---|
| 5-hydroxy-1H-pyrrole-2-carboxylic acid |