EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N2O4S |
| Net Charge | 0 |
| Average Mass | 260.315 |
| Monoisotopic Mass | 260.08308 |
| SMILES | [H][C@]12CS(=O)[C@@H](CCCCC(=O)O)[C@@]1([H])NC(=O)N2 |
| InChI | InChI=1S/C10H16N2O4S/c13-8(14)4-2-1-3-7-9-6(5-17(7)16)11-10(15)12-9/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15)/t6-,7-,9-,17?/m0/s1 |
| InChIKey | KCSKCIQYNAOBNQ-YBSFLMRUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| biotin sulfoxide (CHEBI:62193) has role metabolite (CHEBI:25212) |
| biotin sulfoxide (CHEBI:62193) is a biotins (CHEBI:51570) |
| biotin sulfoxide (CHEBI:62193) is a sulfoxide (CHEBI:22063) |
| biotin sulfoxide (CHEBI:62193) is conjugate acid of biotinate sulfoxide(1−) (CHEBI:62046) |
| Incoming Relation(s) |
| biotin sulfone (CHEBI:74092) has functional parent biotin sulfoxide (CHEBI:62193) |
| biotinate sulfoxide(1−) (CHEBI:62046) is conjugate base of biotin sulfoxide (CHEBI:62193) |
| IUPAC Name |
|---|
| 5-[(3aS,4S,6aR)-5-oxido-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoic acid |
| Synonym | Source |
|---|---|
| biotin S-oxide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4492830 | Reaxys |
| CAS:10406-89-0 | ChemIDplus |
| Citations |
|---|