EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25Cl2N5O3 |
| Net Charge | 0 |
| Average Mass | 502.402 |
| Monoisotopic Mass | 501.13345 |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2cccc(Cl)c2Cl)n(-c2ccc3c(c2)C[C@@H](C(=O)O)NC3)n1 |
| InChI | InChI=1S/C24H25Cl2N5O3/c1-24(2,3)19-11-20(29-23(34)28-17-6-4-5-16(25)21(17)26)31(30-19)15-8-7-13-12-27-18(22(32)33)10-14(13)9-15/h4-9,11,18,27H,10,12H2,1-3H3,(H,32,33)(H2,28,29,34)/t18-/m0/s1 |
| InChIKey | CMUVVEBHULJOFP-SFHVURJKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DP-987 (CHEBI:62173) is a dichlorobenzene (CHEBI:23697) |
| DP-987 (CHEBI:62173) is a isoquinolines (CHEBI:24922) |
| DP-987 (CHEBI:62173) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| DP-987 (CHEBI:62173) is a phenylureas (CHEBI:134043) |
| DP-987 (CHEBI:62173) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| (3S)-6-(3-tert-butyl-5-{[(2,3-dichlorophenyl)carbamoyl]amino}-1H-pyrazol-1-yl)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
| Synonym | Source |
|---|---|
| DP-987 | PDB |
| Citations |
|---|