EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:62150 - (3,4-dimethoxyphenyl)methanol
| Formula | C9H12O3 |
| Net Charge | 0 |
| Average Mass | 168.192 |
| Monoisotopic Mass | 168.07864 |
| SMILES | COc1ccc(CO)cc1OC |
| InChI | InChI=1S/C9H12O3/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5,10H,6H2,1-2H3 |
| InChIKey | OEGPRYNGFWGMMV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phanerochaete chrysosporium (ncbitaxon:5306) | - | PubMed (16349197) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3,4-dimethoxyphenyl)methanol (CHEBI:62150) has role fungal metabolite (CHEBI:76946) |
| (3,4-dimethoxyphenyl)methanol (CHEBI:62150) is a benzyl alcohols (CHEBI:22743) |
| (3,4-dimethoxyphenyl)methanol (CHEBI:62150) is a dimethoxybenzene (CHEBI:51681) |
| (3,4-dimethoxyphenyl)methanol (CHEBI:62150) is a primary alcohol (CHEBI:15734) |
| Incoming Relation(s) |
| 3,4-dimethoxybenzyl acetate (CHEBI:86588) has functional parent (3,4-dimethoxyphenyl)methanol (CHEBI:62150) |
| veratryl alcohol methyl ether (CHEBI:86961) has functional parent (3,4-dimethoxyphenyl)methanol (CHEBI:62150) |
| 3,4-dimethoxybenzyl group (CHEBI:55503) is substituent group from (3,4-dimethoxyphenyl)methanol (CHEBI:62150) |
| IUPAC Name |
|---|
| (3,4-dimethoxyphenyl)methanol |
| Synonyms | Source |
|---|---|
| 3,4-dimethoxybenzenemethanol | NIST Chemistry WebBook |
| 3,4-dimethoxybenzyl alcohol | ChemIDplus |
| 3,4-dimethoxyphenylmethyl alcohol | ChemIDplus |
| veratrole alcohol | ChEBI |
| veratryl alcohol | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (3,4-dimethoxyphenyl)methanol | UniProt |
| Citations |
|---|