EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O17 |
| Net Charge | 0 |
| Average Mass | 518.421 |
| Monoisotopic Mass | 518.14830 |
| SMILES | O=C(O)[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O |
| WURCS | WURCS=2.0/2,3,2/[a2122h-1b_1-5][a2122A-1b_1-5]/1-2-1/a4-b1_b3-c1 |
| InChI | InChI=1S/C18H30O17/c19-1-3-5(21)6(22)9(25)17(32-3)34-13-10(26)14(15(28)29)35-18(11(13)27)33-12-4(2-20)31-16(30)8(24)7(12)23/h3-14,16-27,30H,1-2H2,(H,28,29)/t3-,4-,5-,6+,7-,8-,9-,10+,11-,12-,13+,14+,16-,17+,18-/m1/s1 |
| InChIKey | WLGYAYLOJBIVIL-DNZDHMGISA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-D-Glcp-(1→3)-β-D-GlcpA-(1→4)-β-D-Glcp (CHEBI:62114) has role epitope (CHEBI:53000) |
| β-D-Glcp-(1→3)-β-D-GlcpA-(1→4)-β-D-Glcp (CHEBI:62114) is a trisaccharide (CHEBI:27150) |
| IUPAC Name |
|---|
| β-D-glucopyranosyl-(1→3)-β-D-glucopyranuronosyl-(1→4)-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| β-D-Glc-(1→3)-β-D-GlcA-(1→4)-β-D-Glc | ChEBI |
| (Glc)2 (GlcA)1 | KEGG GLYCAN |
| β-D-glucosyl-(1→3)-β-D-glucuronosyl-(1→4)-β-D-glucose | ChEBI |
| Citations |
|---|