EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34O6 |
| Net Charge | 0 |
| Average Mass | 430.541 |
| Monoisotopic Mass | 430.23554 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](C(=O)COC(=O)CCC(=O)O)CC[C@@]21[H] |
| InChI | InChI=1S/C25H34O6/c1-24-11-9-16(26)13-15(24)3-4-17-18-5-6-20(25(18,2)12-10-19(17)24)21(27)14-31-23(30)8-7-22(28)29/h13,17-20H,3-12,14H2,1-2H3,(H,28,29)/t17-,18-,19-,20+,24-,25-/m0/s1 |
| InChIKey | CYWICJWKZPXJSA-PQWRYPMOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-deoxycorticosterone-21-hemisuccinate (CHEBI:62112) has functional parent 11-deoxycorticosterone (CHEBI:16973) |
| 11-deoxycorticosterone-21-hemisuccinate (CHEBI:62112) has functional parent succinic acid (CHEBI:15741) |
| 11-deoxycorticosterone-21-hemisuccinate (CHEBI:62112) is a 20-oxo steroid (CHEBI:36885) |
| 11-deoxycorticosterone-21-hemisuccinate (CHEBI:62112) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| 11-deoxycorticosterone-21-hemisuccinate (CHEBI:62112) is a dicarboxylic acid monoester (CHEBI:36244) |
| 11-deoxycorticosterone-21-hemisuccinate (CHEBI:62112) is a hemisuccinate (CHEBI:138979) |
| 11-deoxycorticosterone-21-hemisuccinate (CHEBI:62112) is a steroid ester (CHEBI:47880) |
| IUPAC Name |
|---|
| 4-[(3,20-dioxopregn-4-en-21-yl)oxy]-4-oxobutanoic acid |
| Synonyms | Source |
|---|---|
| 11-Deoxycorticosterone hydrogen succinate | KEGG COMPOUND |
| 21-(3-Carboxy-1-oxopropoxy)pregn-4-ene-3,20-dione | KEGG COMPOUND |
| 21-hydroxypregn-4-ene-3,20-dione 21-(hydrogen succinate) | ChemIDplus |
| 21-hydroxyprogesterone 21-hemisuccinate | ChEBI |
| 21-hydroxyprogesterone 21-(hydrogen succinate) | ChEBI |
| 4-(progesteron-21-yloxy)-4-oxobutanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C15425 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2513401 | Reaxys |
| CAS:10215-74-4 | ChemIDplus |
| Citations |
|---|