EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O4S2 |
| Net Charge | 0 |
| Average Mass | 254.333 |
| Monoisotopic Mass | 254.03950 |
| SMILES | N[C@@H](CSCSC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H14N2O4S2/c8-4(6(10)11)1-14-3-15-2-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5-/m0/s1 |
| InChIKey | JMQMNWIBUCGUDO-WHFBIAKZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-djenkolic acid (CHEBI:6211) has role plant metabolite (CHEBI:76924) |
| L-djenkolic acid (CHEBI:6211) has role toxin (CHEBI:27026) |
| L-djenkolic acid (CHEBI:6211) is a L-cysteine derivative (CHEBI:83824) |
| L-djenkolic acid (CHEBI:6211) is a dithioacetal (CHEBI:59794) |
| L-djenkolic acid (CHEBI:6211) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| (2R,2'R)-3,3'-(methylenedisulfanediyl)bis(2-aminopropanoic acid) |
| Synonyms | Source |
|---|---|
| Djenkolic acid | KEGG COMPOUND |
| 3,3'-(Methylenedithio)dialanine | ChemIDplus |
| beta,beta'-Methylenedithiodialanine | ChemIDplus |
| 3,3'-Methylenedithiobis(2-aminopropanoic acid) | ChemIDplus |
| L-Cysteine thioacetal of formaldehyde | ChemIDplus |
| S,S'-methylene-bis-L-cysteine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C08275 | KEGG COMPOUND |
| C00001356 | KNApSAcK |
| Djenkolic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1713584 | Reaxys |
| CAS:498-59-9 | KEGG COMPOUND |
| CAS:498-59-9 | ChemIDplus |
| Citations |
|---|