EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19O4 |
| Net Charge | -1 |
| Average Mass | 263.313 |
| Monoisotopic Mass | 263.12888 |
| SMILES | CC1=CC(=O)CC(C)(C)C1(O)/C=C/C(C)=C\C(=O)[O-] |
| InChI | InChI=1S/C15H20O4/c1-10(7-13(17)18)5-6-15(19)11(2)8-12(16)9-14(15,3)4/h5-8,19H,9H2,1-4H3,(H,17,18)/p-1/b6-5+,10-7- |
| InChIKey | JLIDBLDQVAYHNE-LXGGSRJLSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-cis-abscisate (CHEBI:62071) is a abscisates (CHEBI:62432) |
| 2-cis-abscisate (CHEBI:62071) is a monocarboxylic acid anion (CHEBI:35757) |
| 2-cis-abscisate (CHEBI:62071) is conjugate base of 2-cis-abscisic acid (CHEBI:22152) |
| Incoming Relation(s) |
| (+)-abscisate (CHEBI:37569) is a 2-cis-abscisate (CHEBI:62071) |
| 2-cis-abscisic acid (CHEBI:22152) is conjugate acid of 2-cis-abscisate (CHEBI:62071) |
| Synonyms | Source |
|---|---|
| 2-cis-abscisate(1−) | ChEBI |
| 2-cis-abscisate anion | ChEBI |
| 2-cis-abscisic acid anion | ChEBI |
| abscisate | ChEBI |
| abscisate(1−) | ChEBI |
| abscisate anion | ChEBI |