EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34O4 |
| Net Charge | 0 |
| Average Mass | 374.521 |
| Monoisotopic Mass | 374.24571 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@@H](C)OCC(=O)O |
| InChI | InChI=1S/C23H34O4/c1-14(27-13-21(25)26)18-6-7-19-17-5-4-15-12-16(24)8-10-22(15,2)20(17)9-11-23(18,19)3/h12,14,17-20H,4-11,13H2,1-3H3,(H,25,26)/t14-,17+,18-,19+,20+,22+,23-/m1/s1 |
| InChIKey | VUKWZNZHAKAFNU-LBPUPLFVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (20R)-20-(carboxymethyl)oxypregn-4-en-3-one (CHEBI:62044) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| (20R)-20-(carboxymethyl)oxypregn-4-en-3-one (CHEBI:62044) is a monocarboxylic acid (CHEBI:25384) |
| (20R)-20-(carboxymethyl)oxypregn-4-en-3-one (CHEBI:62044) is a steroid acid (CHEBI:47891) |
| IUPAC Name |
|---|
| {[(20R)-3-oxopregn-4-en-20-yl]oxy}acetic acid |
| Synonym | Source |
|---|---|
| (20R)-20-hydroxypregn-4-en-3-one carboxymethyl ether | ChEBI |
| Citations |
|---|