EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34O5 |
| Net Charge | 0 |
| Average Mass | 390.520 |
| Monoisotopic Mass | 390.24062 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)C(=O)CC[C@@]34[H])[C@@]1(C)CC[C@H](OC(=O)CCC(=O)O)C2 |
| InChI | InChI=1S/C23H34O5/c1-22-11-9-15(28-21(27)8-7-20(25)26)13-14(22)3-4-16-17-5-6-19(24)23(17,2)12-10-18(16)22/h14-18H,3-13H2,1-2H3,(H,25,26)/t14-,15+,16+,17+,18+,22+,23+/m1/s1 |
| InChIKey | ZXXJWQGLXHCSFH-YZGNVQHTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etiocholanolone hemisuccinate (CHEBI:62040) is a 17-oxo steroid (CHEBI:19168) |
| etiocholanolone hemisuccinate (CHEBI:62040) is a dicarboxylic acid monoester (CHEBI:36244) |
| etiocholanolone hemisuccinate (CHEBI:62040) is a hemisuccinate (CHEBI:138979) |
| etiocholanolone hemisuccinate (CHEBI:62040) is a sterol ester (CHEBI:35915) |
| IUPAC Name |
|---|
| 4-oxo-4-{[(3β,5β)-17-oxoandrostan-3-yl]oxy}butanoic acid |
| Synonyms | Source |
|---|---|
| etiocholanolone succinate | ChEBI |
| 4-[(epiandrosteron-3β-yl)oxy]-4-oxobutanoic acid | ChEBI |
| 3α-etiocholanolone hemisuccinate | ChEBI |
| 5β-androsterone hemisuccinate | ChEBI |
| 5β-androsterone succinate | ChEBI |
| 3α-etiocholanolone succinate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7365236 | Reaxys |
| Citations |
|---|