EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H31N5O9 |
| Net Charge | 0 |
| Average Mass | 461.472 |
| Monoisotopic Mass | 461.21218 |
| SMILES | C[C@H](N)C(=O)N[C@H](CCC(=O)N[C@H](CCC[C@H](N)C(=O)O)C(=O)N[C@H](C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C18H31N5O9/c1-8(19)14(25)23-12(18(31)32)6-7-13(24)22-11(5-3-4-10(20)17(29)30)15(26)21-9(2)16(27)28/h8-12H,3-7,19-20H2,1-2H3,(H,21,26)(H,22,24)(H,23,25)(H,27,28)(H,29,30)(H,31,32)/t8-,9+,10-,11+,12+/m0/s1 |
| InChIKey | VFGFFQOPKZHQLZ-RNWYCLNJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-Ala-γ-D-Glu-meso-Dap-D-Ala (CHEBI:62015) is a tetrapeptide (CHEBI:48030) |
| L-Ala-γ-D-Glu-meso-Dap-D-Ala (CHEBI:62015) is conjugate acid of L-Ala-γ-D-Glu-meso-Dap-D-Ala(1−) (CHEBI:61983) |
| Incoming Relation(s) |
| L-Ala-γ-D-Glu-meso-Dap-D-Ala(1−) (CHEBI:61983) is conjugate base of L-Ala-γ-D-Glu-meso-Dap-D-Ala (CHEBI:62015) |
| IUPAC Name |
|---|
| L-alanyl-N-[(2R,6S)-6-amino-6-carboxy-1-{[(1R)-1-carboxyethyl]amino}-1-oxohexan-2-yl]-D-glutamine |
| Synonym | Source |
|---|---|
| L-Ala-γ-D-Glu-Dap-D-Ala | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15589905 | Reaxys |