EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14NO8P |
| Net Charge | 0 |
| Average Mass | 259.151 |
| Monoisotopic Mass | 259.04570 |
| SMILES | N[C@@H](COP(=O)(O)OCC(O)CO)C(=O)O |
| InChI | InChI=1S/C6H14NO8P/c7-5(6(10)11)3-15-16(12,13)14-2-4(9)1-8/h4-5,8-9H,1-3,7H2,(H,10,11)(H,12,13)/t4?,5-/m0/s1 |
| InChIKey | ZWZWYGMENQVNFU-AKGZTFGVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycerol 1-phosphoserine (CHEBI:62013) is a L-serine derivative (CHEBI:84135) |
| glycerol 1-phosphoserine (CHEBI:62013) is a glycerol 1-phosphodiester (CHEBI:55491) |
| glycerol 1-phosphoserine (CHEBI:62013) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| glycerol 1-phosphoserine (CHEBI:62013) is conjugate acid of glycerol 1-phosphoserine(1−) (CHEBI:61931) |
| Incoming Relation(s) |
| sn-glycero-3-phosphoserine (CHEBI:64945) is a glycerol 1-phosphoserine (CHEBI:62013) |
| glycerol 1-phosphoserine(1−) (CHEBI:61931) is conjugate base of glycerol 1-phosphoserine (CHEBI:62013) |
| IUPAC Name |
|---|
| O-[(2,3-dihydroxypropoxy)(hydroxy)phosphoryl]-L-serine |
| Synonyms | Source |
|---|---|
| 1-glycerophosphoserine | ChEBI |
| Glycerophosphoserine | ChemIDplus |
| glycero-1-phosphoserine | ChEBI |
| L-Serine 2,3-dihydroxypropyl hydrogen phosphate | ChemIDplus |
| L-serine 1-phosphoglycerol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD0-2030 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:26289-09-8 | ChemIDplus |