EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H38N7O20P3S2 |
| Net Charge | 0 |
| Average Mass | 889.642 |
| Monoisotopic Mass | 889.08259 |
| SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)CS(=O)(=O)O |
| InChI | InChI=1S/C23H38N7O20P3S2/c1-23(2,18(34)21(35)26-4-3-13(31)25-5-6-54-14(32)8-55(43,44)45)9-47-53(41,42)50-52(39,40)46-7-12-17(49-51(36,37)38)16(33)22(48-12)30-11-29-15-19(24)27-10-28-20(15)30/h10-12,16-18,22,33-34H,3-9H2,1-2H3,(H,25,31)(H,26,35)(H,39,40)(H,41,42)(H2,24,27,28)(H2,36,37,38)(H,43,44,45)/t12-,16-,17-,18+,22-/m1/s1 |
| InChIKey | LFBBBBRKKCUFRH-GRFIIANRSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfoacetyl-CoA (CHEBI:61992) has functional parent coenzyme A (CHEBI:15346) |
| sulfoacetyl-CoA (CHEBI:61992) has functional parent sulfoacetic acid (CHEBI:50519) |
| sulfoacetyl-CoA (CHEBI:61992) is a acyl-CoA (CHEBI:17984) |
| sulfoacetyl-CoA (CHEBI:61992) is conjugate acid of sulfoacetyl-CoA(5−) (CHEBI:61994) |
| Incoming Relation(s) |
| sulfoacetyl-CoA(5−) (CHEBI:61994) is conjugate base of sulfoacetyl-CoA (CHEBI:61992) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-(3-{(3R)-3-hydroxy-2,2-dimethyl-4-[(3-{[2-(sulfoacetylsulfanyl)ethyl]amino}-3-oxopropyl)amino]-4-oxobutyl} dihydrogen diphosphate) |
| Synonym | Source |
|---|---|
| sulfoacetyl-coenzyme-A | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-12645 | MetaCyc |
| Citations |
|---|