EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7NO6 |
| Net Charge | -2 |
| Average Mass | 189.123 |
| Monoisotopic Mass | 189.02843 |
| SMILES | [NH3+][C@@H](CC(C(=O)[O-])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C6H9NO6/c7-3(6(12)13)1-2(4(8)9)5(10)11/h2-3H,1,7H2,(H,8,9)(H,10,11)(H,12,13)/p-2/t3-/m0/s1 |
| InChIKey | UHBYWPGGCSDKFX-VKHMYHEASA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-carboxy-L-glutamic acid zwitterion(2−) (CHEBI:61938) is a ammonium ion derivative (CHEBI:35274) |
| γ-carboxy-L-glutamic acid zwitterion(2−) (CHEBI:61938) is a tricarboxylic acid dianion (CHEBI:36300) |
| γ-carboxy-L-glutamic acid zwitterion(2−) (CHEBI:61938) is conjugate acid of γ-carboxy-L-glutamate(3−) (CHEBI:142422) |
| γ-carboxy-L-glutamic acid zwitterion(2−) (CHEBI:61938) is conjugate base of γ-carboxy-L-glutamic acid zwitterion (CHEBI:61936) |
| Incoming Relation(s) |
| γ-carboxy-L-glutamic acid zwitterion (CHEBI:61936) is conjugate acid of γ-carboxy-L-glutamic acid zwitterion(2−) (CHEBI:61938) |
| γ-carboxy-L-glutamate(3−) (CHEBI:142422) is conjugate base of γ-carboxy-L-glutamic acid zwitterion(2−) (CHEBI:61938) |
| IUPAC Name |
|---|
| (3S)-3-ammoniopropane-1,1,3-tricarboxylate |
| Synonyms | Source |
|---|---|
| (3S)-3-ammonio-1,1,3-propanetricarboxylate | ChEBI |
| gamma-carboxyglutamate | ChEBI |
| γ-carboxyglutamate | ChEBI |
| γ-carboxy-L-glutamate | ChEBI |