EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H21N3O3S |
| Net Charge | 0 |
| Average Mass | 263.363 |
| Monoisotopic Mass | 263.13036 |
| SMILES | N[C@@H](CCCCNC(=O)[C@@H](N)CCS)C(=O)O |
| InChI | InChI=1S/C10H21N3O3S/c11-7(4-6-17)9(14)13-5-2-1-3-8(12)10(15)16/h7-8,17H,1-6,11-12H2,(H,13,14)(H,15,16)/t7-,8-/m0/s1 |
| InChIKey | YPBBRHGQGCWAOR-YUMQZZPRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-L-homocysteinyl-L-lysine (CHEBI:61869) is a N6-acyl-L-lysine (CHEBI:16232) |
| IUPAC Name |
|---|
| N6-L-homocysteinyl-L-lysine |
| Synonyms | Source |
|---|---|
| Nε-Hcy-Lys | ChEBI |
| Nε-L-homocysteyl-L-lysine | ChEBI |
| N-homocysteinylated lysine | ChEBI |
| Nε-L-Hcy-L-Lys | ChEBI |
| (2S)-2-amino-6-{[(2S)-2-amino-4-sulfanylbutanoyl]amino}hexanoic acid | IUPAC |
| Citations |
|---|