EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H73NO6S |
| Net Charge | 0 |
| Average Mass | 672.070 |
| Monoisotopic Mass | 671.51586 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OCC(CSC[C@H](N)C(=O)O)OC(=O)CCCCCCCCCCCCCCC |
| InChI | InChI=1S/C38H73NO6S/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-36(40)44-31-34(32-46-33-35(39)38(42)43)45-37(41)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h34-35H,3-33,39H2,1-2H3,(H,42,43)/t34?,35-/m0/s1 |
| InChIKey | UPAQRWMRKQCLSD-HTIIIDOHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycoplasma genitalium (ncbitaxon:2097) | - | PubMed (22817898) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Toll-like receptor 2 agonist An agonist that selectively binds to and activates the Toll-like receptor 2 (TLR 2, TLR-2) protein. Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dipalmitoyl-S-glycerylcysteine (CHEBI:61842) has functional parent hexadecanoic acid (CHEBI:15756) |
| 2,3-dipalmitoyl-S-glycerylcysteine (CHEBI:61842) has role Mycoplasma genitalium metabolite (CHEBI:131604) |
| 2,3-dipalmitoyl-S-glycerylcysteine (CHEBI:61842) has role Toll-like receptor 2 agonist (CHEBI:77161) |
| 2,3-dipalmitoyl-S-glycerylcysteine (CHEBI:61842) is a L-cysteine thioether (CHEBI:27532) |
| IUPAC Name |
|---|
| S-[2,3-bis(hexadecanoyloxy)propyl]-L-cysteine |
| Synonyms | Source |
|---|---|
| 2,3-dihexadecanoyl-S-glyceryl cysteine | ChEBI |
| 2,3-dihexadecanoyl-S-glyceryl-L-cysteine | ChEBI |
| 2,3-dipalmitoyl-S-glyceryl cysteine | ChEBI |
| 2,3-dipalmitoyl-S-glyceryl-L-cysteine | ChEBI |
| S-[2,3-bis(palmitoyloxy)-(2R)-propyl]-(R)-cysteine | ChEBI |
| S-[2,3-bis(palmitoyloxy)propyl]cysteine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6673182 | Reaxys |
| Citations |
|---|