EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:61836 - α-D-Galp-(1→4)-β-D-GlcpNAc
| Formula | C14H25NO11 |
| Net Charge | 0 |
| Average Mass | 383.350 |
| Monoisotopic Mass | 383.14276 |
| SMILES | CC(=O)N[C@@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](CO)O[C@H]1O |
| WURCS | WURCS=2.0/2,2,1/[a2122h-1b_1-5_2*NCC/3=O][a2112h-1a_1-5]/1-2/a4-b1 |
| InChI | InChI=1S/C14H25NO11/c1-4(18)15-7-9(20)12(6(3-17)24-13(7)23)26-14-11(22)10(21)8(19)5(2-16)25-14/h5-14,16-17,19-23H,2-3H2,1H3,(H,15,18)/t5-,6-,7-,8+,9-,10+,11-,12-,13-,14-/m1/s1 |
| InChIKey | KFEUJDWYNGMDBV-REYAXZTNSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-D-Galp-(1→4)-β-D-GlcpNAc (CHEBI:61836) has functional parent N-acetyl-β-D-glucosamine (CHEBI:28009) |
| α-D-Galp-(1→4)-β-D-GlcpNAc (CHEBI:61836) has functional parent α-D-galactose (CHEBI:28061) |
| α-D-Galp-(1→4)-β-D-GlcpNAc (CHEBI:61836) has role epitope (CHEBI:53000) |
| α-D-Galp-(1→4)-β-D-GlcpNAc (CHEBI:61836) is a amino disaccharide (CHEBI:22480) |
| α-D-Galp-(1→4)-β-D-GlcpNAc (CHEBI:61836) is a glucosamine oligosaccharide (CHEBI:22485) |
| IUPAC Names |
|---|
| 2-acetamido-2-deoxy-4-O-α-D-galactopyranosyl-β-D-glucopyranose |
| α-D-galactopyranosyl-(1→4)-2-acetamido-2-deoxy-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| Gal-α1-4-GlcNAc-β | ChEBI |
| Gal-α-(1→4)-GlcNAc-β | ChEBI |
| 2-(acetylamino)-2-deoxy-4-O-α-D-galactopyranosyl-β-D-glucopyranose | IUPAC |
| α-D-Gal-(1→4)-β-D-GlcNAc | ChEBI |
| Galα1-4GlcNAcβ | ChEBI |
| Gala1-4GlcNAcb | ChEBI |
| Citations |
|---|