EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:61827 - β-melibiose
| Formula | C12H22O11 |
| Net Charge | 0 |
| Average Mass | 342.297 |
| Monoisotopic Mass | 342.11621 |
| SMILES | OC[C@H]1O[C@H](OC[C@H]2O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O |
| WURCS | WURCS=2.0/2,2,1/[a2122h-1b_1-5][a2112h-1a_1-5]/1-2/a6-b1 |
| InChI | InChI=1S/C12H22O11/c13-1-3-5(14)8(17)10(19)12(23-3)21-2-4-6(15)7(16)9(18)11(20)22-4/h3-20H,1-2H2/t3-,4-,5+,6-,7+,8+,9-,10-,11-,12+/m1/s1 |
| InChIKey | DLRVVLDZNNYCBX-ZZFZYMBESA-N |
| Roles Classification |
|---|
| Biological Roles: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. elastin-laminin receptor agonist An agonist that selectively binds to and activates elastin-laminin receptors. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-melibiose (CHEBI:61827) has role epitope (CHEBI:53000) |
| β-melibiose (CHEBI:61827) is a melibiose (CHEBI:28053) |
| IUPAC Names |
|---|
| 6-O-α-D-galactopyranosyl-β-D-glucopyranose |
| α-D-galactopyranosyl-(1→6)-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| Gal-alpha1-6-Glc-beta | ChEBI |
| α-D-Galp-(1→6)-β-D-Glcp | ChEBI |
| O6-α-D-galactopyranosyl-β-D-glucopyranose | ChEBI |
| Galα1-6Glcβ | ChEBI |
| Gala1-6Glcb | ChEBI |
| 6-O-α-D-galactopyranosyl-β-D-glucopyranose | ChEBI |
| Citations |
|---|