EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O5 |
| Net Charge | 0 |
| Average Mass | 150.130 |
| Monoisotopic Mass | 150.05282 |
| SMILES | OC1OC[C@H](O)[C@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a211h-1x_1-5]/1/ |
| InChI | InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3-,4+,5?/m0/s1 |
| InChIKey | SRBFZHDQGSBBOR-HWQSCIPKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). fundamental metabolite Any metabolite produced by all living cells. fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-arabinopyranose (CHEBI:17535) has role Escherichia coli metabolite (CHEBI:76971) |
| L-arabinopyranose (CHEBI:17535) has role mouse metabolite (CHEBI:75771) |
| L-arabinopyranose (CHEBI:17535) is a L-arabinose (CHEBI:30849) |
| Incoming Relation(s) |
| 4-amino-4-deoxy-L-arabinopyranose (CHEBI:46991) has functional parent L-arabinopyranose (CHEBI:17535) |
| agrocinopine A (CHEBI:82804) has functional parent L-arabinopyranose (CHEBI:17535) |
| agrocinopine B (CHEBI:82806) has functional parent L-arabinopyranose (CHEBI:17535) |
| α-L-arabinopyranose (CHEBI:46987) is a L-arabinopyranose (CHEBI:17535) |
| β-L-arabinopyranose (CHEBI:40886) is a L-arabinopyranose (CHEBI:17535) |
| IUPAC Name |
|---|
| L-arabinopyranose |
| Synonyms | Source |
|---|---|
| L-Arabinopyranose | KEGG COMPOUND |
| L-Arabinose | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| L-arabinose | UniProt |
| Citations |
|---|