EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13NO9S |
| Net Charge | 0 |
| Average Mass | 287.246 |
| Monoisotopic Mass | 287.03110 |
| SMILES | CC(=O)N[C@H]1C(O)O[C@H](OS(=O)(=O)O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H13NO9S/c1-2(9)8-3-4(10)5(11)7(16-6(3)12)17-18(13,14)15/h3-7,10-12H,1H3,(H,8,9)(H,13,14,15)/t3-,4-,5+,6?,7-/m1/s1 |
| InChIKey | VEZIBRSKPYBVCG-DXDUYESSSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-6-O-sulfo-D-glucosamine (CHEBI:61791) is a monosaccharide sulfate (CHEBI:24589) |
| N-acetyl-6-O-sulfo-D-glucosamine (CHEBI:61791) is conjugate acid of N-acetyl-D-glucosamine 6-sulfate(1−) (CHEBI:84775) |
| Incoming Relation(s) |
| N-acetyl-D-glucosamine 6-sulfate(1−) (CHEBI:84775) is conjugate base of N-acetyl-6-O-sulfo-D-glucosamine (CHEBI:61791) |
| IUPAC Name |
|---|
| 2-acetamido-2-deoxy-6-O-sulfo-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 6-O-sulfo-GlcNAc | ChEBI |
| (SO3)→6-GlcNAc | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21870660 | Reaxys |
| Citations |
|---|