EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:61772 - β-(1→3)-galactobiose
| Formula | C12H22O11 |
| Net Charge | 0 |
| Average Mass | 342.297 |
| Monoisotopic Mass | 342.11621 |
| SMILES | OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](O)O[C@H](CO)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,2,1/[a2112h-1b_1-5]/1-1/a3-b1 |
| InChI | InChI=1S/C12H22O11/c13-1-3-5(15)7(17)8(18)12(22-3)23-10-6(16)4(2-14)21-11(20)9(10)19/h3-20H,1-2H2/t3-,4-,5+,6+,7+,8-,9-,10+,11-,12+/m1/s1 |
| InChIKey | QIGJYVCQYDKYDW-BAYKCOMVSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-(1→3)-galactobiose (CHEBI:61772) has role epitope (CHEBI:53000) |
| β-(1→3)-galactobiose (CHEBI:61772) is a glycosylgalactose (CHEBI:35317) |
| Incoming Relation(s) |
| β-D-Galp-(1→3)-β-D-Galp-(1→4)-D-Glcp (CHEBI:147880) has functional parent β-(1→3)-galactobiose (CHEBI:61772) |
| β-D-Galp-(1→3)-β-D-Galp-(1→4)-D-GlcpNAc (CHEBI:148473) has functional parent β-(1→3)-galactobiose (CHEBI:61772) |
| β-D-Galp-(1→3)-β-D-Galp-(1→4)-D-Xylp (CHEBI:146882) has functional parent β-(1→3)-galactobiose (CHEBI:61772) |
| IUPAC Name |
|---|
| β-D-galactopyranosyl-(1→3)-β-D-galactopyranose |
| Synonyms | Source |
|---|---|
| β-D-galactosyl-(1→3)-β-D-galactose | ChEBI |
| β-D-Gal-(1→3)-β-D-Gal | ChEBI |
| β-D-Galp-(1→3)-β-D-Galp | ChEBI |
| 3-O-β-D-galactopyranosyl-β-D-galactopyranose | IUPAC |
| Galβ1-3Galβ | ChEBI |
| Galb1-3Galb | ChEBI |
| Citations |
|---|