EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H35NO16 |
| Net Charge | 0 |
| Average Mass | 545.491 |
| Monoisotopic Mass | 545.19558 |
| SMILES | CC(=O)N[C@H]1[C@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](O)O[C@@H]3CO)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/3,3,2/[a2122h-1b_1-5][a2112h-1b_1-5][a2122h-1b_1-5_2*NCC/3=O]/1-2-3/a4-b1_b3-c1 |
| InChI | InChI=1S/C20H35NO16/c1-5(25)21-9-12(28)10(26)6(2-22)34-19(9)37-17-11(27)7(3-23)35-20(15(17)31)36-16-8(4-24)33-18(32)14(30)13(16)29/h6-20,22-24,26-32H,2-4H2,1H3,(H,21,25)/t6-,7-,8-,9-,10-,11+,12-,13-,14-,15-,16-,17+,18-,19+,20+/m1/s1 |
| InChIKey | CRTJRHPGCOAOQC-QLFGYAPHSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-D-GlcpNAc-(1→3)-β-D-Galp-(1→4)-β-D-Glcp (CHEBI:61758) has role epitope (CHEBI:53000) |
| β-D-GlcpNAc-(1→3)-β-D-Galp-(1→4)-β-D-Glcp (CHEBI:61758) is a amino trisaccharide (CHEBI:59266) |
| β-D-GlcpNAc-(1→3)-β-D-Galp-(1→4)-β-D-Glcp (CHEBI:61758) is a glucosamine oligosaccharide (CHEBI:22485) |
| Incoming Relation(s) |
| β-D-GlcpNAc-(1→3)-β-D-Galp-(1→4)-β-D-Glcp-yl group (CHEBI:167892) is substituent group from β-D-GlcpNAc-(1→3)-β-D-Galp-(1→4)-β-D-Glcp (CHEBI:61758) |
| IUPAC Name |
|---|
| 2-acetamido-2-deoxy-β-D-glucopyranosyl-(1→3)-β-D-galactopyranosyl-(1→4)-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| β-D-GlcNAc-(1→3)-β-D-Gal-(1→4)-β-D-Glc | ChEBI |
| (Gal)1 (Glc)1 (GlcNAc)1 | KEGG GLYCAN |
| N-acetyl-β-D-glucosaminyl-(1→3)-β-D-galactosyl-(1→4)-β-D-glucose | ChEBI |
| GlcNAcβ1-3Galβ1-4Glcβ | ChEBI |
| GlcNAcb1-3Galb1-4Glcb | ChEBI |
| O-2-(acetylamino)-2-deoxy-β-D-glucopyranosyl-(1→3)-O-β-D-galactopyranosyl-(1→4)-β-D-glucopyranose | ChEBI |
| Citations |
|---|