EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14O8 |
| Net Charge | 0 |
| Average Mass | 250.203 |
| Monoisotopic Mass | 250.06887 |
| SMILES | C[C@@]1(C(=O)O)OC[C@H]2O[C@@H](O)[C@H](O)[C@@H](O)[C@H]2O1 |
| InChI | InChI=1S/C9H14O8/c1-9(8(13)14)15-2-3-6(17-9)4(10)5(11)7(12)16-3/h3-7,10-12H,2H2,1H3,(H,13,14)/t3-,4-,5-,6+,7-,9-/m1/s1 |
| InChIKey | QVVFNJUJKXWFAU-CECBSOHTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,6-O-[(1R)-1-carboxyethylidene]-β-D-galactose (CHEBI:61745) is a 4,6-O-[(1R)-1-carboxyethylidene]-D-galactose (CHEBI:61747) |
| IUPAC Name |
|---|
| 4,6-O-[(1R)-1-carboxyethylidene]-β-D-galactopyranose |
| Synonyms | Source |
|---|---|
| 4,6-pyruvylated β-D-galactose | ChEBI |
| 4,6pyDGalβ R isomer | ChEBI |
| β-D-galactose 4,6-pyruvate acetal | ChEBI |
| Citations |
|---|