EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O11 |
| Net Charge | 0 |
| Average Mass | 342.297 |
| Monoisotopic Mass | 342.11621 |
| SMILES | [H][C@@]1([C@H](O)CO)O[C@@H](O[C@@H]2[C@H](O)[C@@H](O)O[C@H](CO)[C@H]2O)[C@H](O)[C@H]1O |
| WURCS | WURCS=2.0/2,2,1/[a1122h-1a_1-5][a2112h-1b_1-4]/1-2/a3-b1 |
| InChI | InChI=1S/C12H22O11/c13-1-3(15)9-6(17)7(18)12(22-9)23-10-5(16)4(2-14)21-11(20)8(10)19/h3-20H,1-2H2/t3-,4-,5-,6-,7-,8+,9+,10+,11+,12+/m1/s1 |
| InChIKey | RZAIXMBMAFKSQR-LXQZTTDRSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-D-Galf-(1→3)-α-D-Manp (CHEBI:61742) has role epitope (CHEBI:53000) |
| β-D-Galf-(1→3)-α-D-Manp (CHEBI:61742) is a glycosylmannose (CHEBI:35318) |
| IUPAC Name |
|---|
| β-D-galactofuranosyl-(1→3)-α-D-mannopyranose |
| Synonyms | Source |
|---|---|
| 3-O-β-D-galactofuranosyl-α-D-mannopyranose | IUPAC |
| (Galf)1 (Man)1 | KEGG GLYCAN |
| Manual Xrefs | Databases |
|---|---|
| G03571 | KEGG GLYCAN |
| Citations |
|---|