EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N3O13P3 |
| Net Charge | -4 |
| Average Mass | 477.152 |
| Monoisotopic Mass | 476.97614 |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])O2)c(=O)nc1N |
| InChI | InChI=1S/C10H18N3O13P3/c1-5-3-13(10(15)12-9(5)11)8-2-6(14)7(24-8)4-23-28(19,20)26-29(21,22)25-27(16,17)18/h3,6-8,14H,2,4H2,1H3,(H,19,20)(H,21,22)(H2,11,12,15)(H2,16,17,18)/p-4/t6-,7+,8+/m0/s1 |
| InChIKey | NGYHUCPPLJOZIX-XLPZGREQSA-J |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methyl-dCTP(4−) (CHEBI:61731) is a 2'-deoxyribonucleoside triphosphate oxoanion (CHEBI:61662) |
| 5-methyl-dCTP(4−) (CHEBI:61731) is conjugate base of 5-methyl-dCTP (CHEBI:61766) |
| Incoming Relation(s) |
| 5-methyl-dCTP (CHEBI:61766) is conjugate acid of 5-methyl-dCTP(4−) (CHEBI:61731) |
| IUPAC Name |
|---|
| 2'-deoxy-5-methyl-5'-O-({[(phosphonatooxy)phosphinato]oxy}phosphinato)cytidine |
| UniProt Name | Source |
|---|---|
| 5-methyl-dCTP | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-1094 | MetaCyc |