EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9N3O3 |
| Net Charge | 0 |
| Average Mass | 147.134 |
| Monoisotopic Mass | 147.06439 |
| SMILES | NC(=O)NC[C@H](N)C(=O)O |
| InChI | InChI=1S/C4H9N3O3/c5-2(3(8)9)1-7-4(6)10/h2H,1,5H2,(H,8,9)(H3,6,7,10)/t2-/m0/s1 |
| InChIKey | GZYFIMLSHBLMKF-REOHCLBHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-Albizziine (CHEBI:6173) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Synonyms | Source |
|---|---|
| L-Albizziine | KEGG COMPOUND |
| Albizziin | KEGG COMPOUND |