EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H21N2O7PS |
| Net Charge | -2 |
| Average Mass | 356.337 |
| Monoisotopic Mass | 356.08181 |
| SMILES | CC(C)(COP(=O)([O-])[O-])[C@@H](O)C(=O)NCCC(=O)NCCS |
| InChI | InChI=1S/C11H23N2O7PS/c1-11(2,7-20-21(17,18)19)9(15)10(16)13-4-3-8(14)12-5-6-22/h9,15,22H,3-7H2,1-2H3,(H,12,14)(H,13,16)(H2,17,18,19)/p-2/t9-/m0/s1 |
| InChIKey | JDMUPRLRUUMCTL-VIFPVBQESA-L |
| Roles Classification |
|---|
| Biological Roles: | prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-pantetheine 4'-phosphate(2−) (CHEBI:61723) has role prosthetic group (CHEBI:26348) |
| D-pantetheine 4'-phosphate(2−) (CHEBI:61723) is a pantetheine 4'-phosphate(2−) (CHEBI:47942) |
| D-pantetheine 4'-phosphate(2−) (CHEBI:61723) is conjugate base of D-pantetheine 4'-phosphate (CHEBI:4222) |
| Incoming Relation(s) |
| (R)-4'-phospho-S-sulfopantetheine(3−) (CHEBI:177302) has functional parent D-pantetheine 4'-phosphate(2−) (CHEBI:61723) |
| (R)-4'-phosphopantetheine sulfonate(3−) (CHEBI:177300) has functional parent D-pantetheine 4'-phosphate(2−) (CHEBI:61723) |
| D-pantetheine 4'-phosphate (CHEBI:4222) is conjugate acid of D-pantetheine 4'-phosphate(2−) (CHEBI:61723) |
| IUPAC Name |
|---|
| N3-[(2R)-2-hydroxy-3,3-dimethyl-4-(phosphonatooxy)butanoyl]-N-(2-sulfanylethyl)-β-alaninamide |
| UniProt Name | Source |
|---|---|
| (R)-4'-phosphopantetheine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| PANTETHEINE-P | MetaCyc |