EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H34FeN4O4S2 |
| Net Charge | -2 |
| Average Mass | 682.649 |
| Monoisotopic Mass | 682.13818 |
| SMILES | CC1=C(CCC(=O)[O-])C2=[N+]3C1=Cc1c(C)c(C(C)S)c4[n]1[Fe-2]31[n]3c(c(C)c(CCC(=O)[O-])c3=C2)=CC2=[N+]1C(=C4)C(C)=C2C(C)S |
| InChI | InChI=1S/C34H38N4O4S2.Fe/c1-15-21(7-9-31(39)40)27-14-28-22(8-10-32(41)42)16(2)24(36-28)12-29-34(20(6)44)18(4)26(38-29)13-30-33(19(5)43)17(3)25(37-30)11-23(15)35-27;/h11-14,19-20H,7-10H2,1-6H3,(H6,35,36,37,38,39,40,41,42,43,44);/q;+2/p-4/b23-11-,24-12-,25-11-,26-13-,27-14-,28-14-,29-12-,30-13-; |
| InChIKey | XSWPXBWSKQRBRZ-IDTMDVKXSA-J |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferroheme c(2−) (CHEBI:61717) has role cofactor (CHEBI:23357) |
| ferroheme c(2−) (CHEBI:61717) is a cyclic tetrapyrrole anion (CHEBI:58941) |
| ferroheme c(2−) (CHEBI:61717) is conjugate base of ferroheme c (CHEBI:60562) |
| Incoming Relation(s) |
| ferroheme c (CHEBI:60562) is conjugate acid of ferroheme c(2−) (CHEBI:61717) |
| Synonym | Source |
|---|---|
| {3,3'-[3,7,12,17-tetramethyl-8,13-bis(1-sulfanylethyl)porphyrin-2,18-diyl-κ4N21,N22,N23,N24]dipropanoato(4−)}ferrate(2−) | ChEBI |
| UniProt Name | Source |
|---|---|
| heme c | UniProt |