EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:617099 - carbimazole
| Formula | C7H10N2O2S |
| Net Charge | 0 |
| Average Mass | 186.236 |
| Monoisotopic Mass | 186.04630 |
| SMILES | CCOC(=O)n1ccn(C)c1=S |
| InChI | InChI=1S/C7H10N2O2S/c1-3-11-7(10)9-5-4-8(2)6(9)12/h4-5H,3H2,1-2H3 |
| InChIKey | CFOYWRHIYXMDOT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antithyroid drug A drug used to treat hyperthyroidism by reducing the excessive production of thyroid hormones. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antithyroid drug A drug used to treat hyperthyroidism by reducing the excessive production of thyroid hormones. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbimazole (CHEBI:617099) has role antithyroid drug (CHEBI:50671) |
| carbimazole (CHEBI:617099) has role prodrug (CHEBI:50266) |
| carbimazole (CHEBI:617099) is a 1,3-dihydroimidazole-2-thiones (CHEBI:139340) |
| carbimazole (CHEBI:617099) is a carbamate ester (CHEBI:23003) |
| IUPAC Name |
|---|
| ethyl 3-methyl-2-thioxo-2,3-dihydro-1H-imidazole-1-carboxylate |
| INNs | Source |
|---|---|
| carbimazol | ChemIDplus |
| carbimazolum | ChemIDplus |
| carbimazole | ChemIDplus |
| carbimazole | WHO MedNet |
| Synonyms | Source |
|---|---|
| Athyromazole | ChemIDplus |
| Carbethoxymethimazole | ChemIDplus |
| Thyrostat | ChemIDplus |
| Ethyl 3-methyl-2-thioimidazoline-1-carboxylate | ChemIDplus |
| Carbinazole | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:144339 | Reaxys |
| CAS:22232-54-8 | KEGG COMPOUND |
| CAS:22232-54-8 | ChemIDplus |
| CAS:22232-54-8 | NIST Chemistry WebBook |
| Citations |
|---|