EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H38N4O7 |
| Net Charge | 0 |
| Average Mass | 602.688 |
| Monoisotopic Mass | 602.27405 |
| SMILES | [H][C@]1(C(=O)O)N/C(=C2/C(=O)C(=O)c3c2nc(Cc2nc(CC4NC(=O)C(C)=C4C=C)c(C)c2CC)c3C)[C@@H](CCC(=O)O)[C@@H]1C |
| InChI | InChI=1S/C33H38N4O7/c1-7-17-13(3)20(11-23-18(8-2)15(5)32(42)36-23)34-22(17)12-21-16(6)25-29(35-21)26(31(41)30(25)40)28-19(9-10-24(38)39)14(4)27(37-28)33(43)44/h8,14,19,23,27,34-35,37H,2,7,9-12H2,1,3-6H3,(H,36,42)(H,38,39)(H,43,44)/b28-26+/t14-,19-,23?,27-/m0/s1 |
| InChIKey | RHKAAOSSVJEZNU-LHYWXDRZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxidized dinoflagellate luciferin (CHEBI:61707) has role oxidized luciferins (CHEBI:25747) |
| oxidized dinoflagellate luciferin (CHEBI:61707) is a amino dicarboxylic acid (CHEBI:36164) |
| oxidized dinoflagellate luciferin (CHEBI:61707) is a bilenes (CHEBI:36736) |
| oxidized dinoflagellate luciferin (CHEBI:61707) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| oxidized dinoflagellate luciferin (CHEBI:61707) is a oxo dicarboxylic acid (CHEBI:36145) |
| oxidized dinoflagellate luciferin (CHEBI:61707) is conjugate acid of oxidized dinoflagellate luciferin(2−) (CHEBI:61708) |
| Incoming Relation(s) |
| oxidized dinoflagellate luciferin(2−) (CHEBI:61708) is conjugate base of oxidized dinoflagellate luciferin (CHEBI:61707) |
| IUPAC Name |
|---|
| (1S,2S,3S)-1-carboxy-3-(2-carboxyethyl)-12-ethyl-2,8,13,18-tetramethyl-17-vinyl-1,2,3,21-tetrahydro-5,7-ethanobilene-a-19(16H),51,52-trione |
| Synonyms | Source |
|---|---|
| oxidised dinoflagellate luciferin | ChEBI |
| (3S,4S,5E)-4-(2-carboxyethyl)-5-[2-({5-[(3-ethenyl-4-methyl-5-oxo-2,5-dihydro-1H-pyrrol-2-yl)methyl]-3-ethyl-4-methyl-1H-pyrrol-2-yl}methyl)-3-methyl-4,5-dioxo-4,5-dihydrocyclopenta[b]pyrrol-6(1H)-ylidene]-3-methyl-L-proline | IUPAC |