EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H40N4O6 |
| Net Charge | 0 |
| Average Mass | 588.705 |
| Monoisotopic Mass | 588.29478 |
| SMILES | [H][C@]1(C(=O)O)N/C(=C2/CC(=O)c3c2nc(Cc2nc(CC4NC(=O)C(C)=C4C=C)c(C)c2CC)c3C)[C@@H](CCC(=O)O)[C@@H]1C |
| InChI | InChI=1S/C33H40N4O6/c1-7-18-14(3)22(12-25-19(8-2)16(5)32(41)36-25)34-24(18)13-23-17(6)28-26(38)11-21(31(28)35-23)30-20(9-10-27(39)40)15(4)29(37-30)33(42)43/h8,15,20,25,29,34-35,37H,2,7,9-13H2,1,3-6H3,(H,36,41)(H,39,40)(H,42,43)/b30-21-/t15-,20-,25?,29-/m0/s1 |
| InChIKey | QUHVVVWAQMRCSJ-IXXPHHLHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | luciferin A low-molecular-mass compound present in bioluminescent organisms that emits light when oxidized in presence of enzyme luciferase. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | luciferin A low-molecular-mass compound present in bioluminescent organisms that emits light when oxidized in presence of enzyme luciferase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dinoflagellate luciferin (CHEBI:61702) has role luciferin (CHEBI:25078) |
| dinoflagellate luciferin (CHEBI:61702) is a amino dicarboxylic acid (CHEBI:36164) |
| dinoflagellate luciferin (CHEBI:61702) is a bilenes (CHEBI:36736) |
| dinoflagellate luciferin (CHEBI:61702) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| dinoflagellate luciferin (CHEBI:61702) is a oxo dicarboxylic acid (CHEBI:36145) |
| dinoflagellate luciferin (CHEBI:61702) is conjugate acid of dinoflagellate luciferin(1−) (CHEBI:61796) |
| Incoming Relation(s) |
| dinoflagellate luciferin(1−) (CHEBI:61796) is conjugate base of dinoflagellate luciferin (CHEBI:61702) |
| IUPAC Name |
|---|
| (1S,2S,3S)-1-carboxy-3-(2-carboxyethyl)-12-ethyl-2,8,13,18-tetramethyl-17-vinyl-1,2,3,21-tetrahydro-5,7-ethanobilene-a-19(16H),52-dione |
| Synonym | Source |
|---|---|
| (3S,4S,5Z)-4-(2-carboxyethyl)-5-[2-({5-[(3-ethenyl-4-methyl-5-oxo-2,5-dihydro-1H-pyrrol-2-yl)methyl]-3-ethyl-4-methyl-1H-pyrrol-2-yl}methyl)-3-methyl-4-oxo-4,5-dihydrocyclopenta[b]pyrrol-6(1H)-ylidene]-3-methyl-L-proline | IUPAC |