EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9O9P |
| Net Charge | 0 |
| Average Mass | 256.103 |
| Monoisotopic Mass | 255.99842 |
| SMILES | [H][C@]1([C@@H](O)COP(=O)(O)O)OC(=O)C(O)=C1O |
| InChI | InChI=1S/C6H9O9P/c7-2(1-14-16(11,12)13)5-3(8)4(9)6(10)15-5/h2,5,7-9H,1H2,(H2,11,12,13)/t2-,5+/m0/s1 |
| InChIKey | KIENGQUGHPTFGC-JLAZNSOCSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-ascorbic acid 6-phosphate (CHEBI:61701) has functional parent L-ascorbic acid (CHEBI:29073) |
| L-ascorbic acid 6-phosphate (CHEBI:61701) is a aldonolactone phosphate (CHEBI:37429) |
| L-ascorbic acid 6-phosphate (CHEBI:61701) is conjugate acid of L-ascorbate 6-phosphate(3−) (CHEBI:61698) |
| Incoming Relation(s) |
| L-ascorbate 6-phosphate(3−) (CHEBI:61698) is conjugate base of L-ascorbic acid 6-phosphate (CHEBI:61701) |
| IUPAC Names |
|---|
| (2S)-2-[(2R)-3,4-dihydroxy-5-oxo-2,5-dihydrofuran-2-yl]-2-hydroxyethyl dihydrogen phosphate |
| 6-O-phospho-L-threo-hex-2-eno-1,4-lactone |
| Synonyms | Source |
|---|---|
| L-ascorbic acid phosphate ester | ChEBI |
| L-ascorbyl phosphate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15626553 | Reaxys |