EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C49H76O4 |
| Net Charge | 0 |
| Average Mass | 729.143 |
| Monoisotopic Mass | 728.57436 |
| SMILES | COc1c(O)c(C)c(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)c(O)c1OC |
| InChI | InChI=1S/C49H76O4/c1-36(2)20-13-21-37(3)22-14-23-38(4)24-15-25-39(5)26-16-27-40(6)28-17-29-41(7)30-18-31-42(8)32-19-33-43(9)34-35-45-44(10)46(50)48(52-11)49(53-12)47(45)51/h20,22,24,26,28,30,32,34,50-51H,13-19,21,23,25,27,29,31,33,35H2,1-12H3/b37-22+,38-24+,39-26+,40-28+,41-30+,42-32+,43-34+ |
| InChIKey | LOJUQFSPYHMHEO-SGHXUWJISA-N |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ubiquinol-8 (CHEBI:61682) has role antineoplastic agent (CHEBI:35610) |
| ubiquinol-8 (CHEBI:61682) is a polyprenylhydroquinone (CHEBI:26253) |
| ubiquinol-8 (CHEBI:61682) is a ubiquinol (CHEBI:17976) |
| IUPAC Name |
|---|
| 2,3-dimethoxy-5-methyl-6-[(2E,6E,10E,14E,18E,22E,26E)-3,7,11,15,19,23,27,31-octamethyldotriaconta-2,6,10,14,18,22,26,30-octaen-1-yl]benzene-1,4-diol |
| Synonyms | Source |
|---|---|
| reduced coenzyme Q8 | ChEBI |
| ubiquinol(8) | ChEBI |
| UniProt Name | Source |
|---|---|
| ubiquinol-8 | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-9956 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14244780 | Reaxys |