EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O2 |
| Net Charge | 0 |
| Average Mass | 278.436 |
| Monoisotopic Mass | 278.22458 |
| SMILES | O=C(O)CCCC/C=C\CCCCCC[C@H]1C=CCC1 |
| InChI | InChI=1S/C18H30O2/c19-18(20)16-10-8-6-4-2-1-3-5-7-9-13-17-14-11-12-15-17/h2,4,11,14,17H,1,3,5-10,12-13,15-16H2,(H,19,20)/b4-2-/t17-/m0/s1 |
| InChIKey | XADKGDBMULSEAC-MMTGSJLXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gorlic acid (CHEBI:61676) is a 13-cyclopent-2-en-1-yltridec-6-enoic acid (CHEBI:61673) |
| IUPAC Name |
|---|
| (6Z)-13-[(1R)-cyclopent-2-en-1-yl]tridec-6-enoic acid |
| Synonyms | Source |
|---|---|
| 13-(1R)-Cp 6c-13:1 | ChEBI |
| 13-Cp 6c-13:1 | ChEBI |
| 13R-(2-cyclopenten-1-yl)-6Z-tridecenoic acid | LIPID MAPS |
| 13R-Cyclopent-2-enyl-tridec-cis-6-ensäure | ChEBI |
| Gorlisäure | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01140020 | LIPID MAPS |