EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H28O2 |
| Net Charge | 0 |
| Average Mass | 252.398 |
| Monoisotopic Mass | 252.20893 |
| SMILES | O=C(O)CCCCCCCCCCC1C=CCC1 |
| InChI | InChI=1S/C16H28O2/c17-16(18)14-8-6-4-2-1-3-5-7-11-15-12-9-10-13-15/h9,12,15H,1-8,10-11,13-14H2,(H,17,18) |
| InChIKey | SRELFLQJDOTNLJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydnocarpic acid (CHEBI:61671) is a cyclopentenyl fatty acid (CHEBI:23497) |
| hydnocarpic acid (CHEBI:61671) is a long-chain fatty acid (CHEBI:15904) |
| hydnocarpic acid (CHEBI:61671) is a monounsaturated fatty acid (CHEBI:25413) |
| Incoming Relation(s) |
| (R)-hydnocarpic acid (CHEBI:61675) is a hydnocarpic acid (CHEBI:61671) |
| IUPAC Name |
|---|
| 11-cyclopent-2-en-1-ylundecanoic acid |
| Synonyms | Source |
|---|---|
| Hydnocarpsäure | ChEBI |
| 11-cyclopent-2-enyl-undecanoic acid | ChEBI |
| 11-Cp 11:0 | ChEBI |
| 11-Cyclopent-2-enyl-undecansäure | ChEBI |
| 11-(2-Cyclopenten-1-yl)undecanoic acid | LIPID MAPS |
| hydnocarpic acids | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01140023 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2051523 | Reaxys |
| Citations |
|---|