EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO2S |
| Net Charge | 0 |
| Average Mass | 189.280 |
| Monoisotopic Mass | 189.08235 |
| SMILES | CC1(C)N[C@@H](C(=O)O)C(C)(C)S1 |
| InChI | InChI=1S/C8H15NO2S/c1-7(2)5(6(10)11)9-8(3,4)12-7/h5,9H,1-4H3,(H,10,11)/t5-/m0/s1 |
| InChIKey | ILJCRVOHKUEEIW-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,S-isopropylidene-D-penicillamine (CHEBI:61637) has role allergen (CHEBI:50904) |
| N,S-isopropylidene-D-penicillamine (CHEBI:61637) is a thiazolidinemonocarboxylic acid (CHEBI:48875) |
| IUPAC Name |
|---|
| (4S)-2,2,5,5-tetramethyl-1,3-thiazolidine-4-carboxylic acid |
| Synonym | Source |
|---|---|
| (S)-2,2,5,5-tetramethyl-1,3-thiazolidine-4-carboxylic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:82303 | Reaxys |
| CAS:29041-38-1 | Reaxys |
| Citations |
|---|