EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24O13 |
| Net Charge | 0 |
| Average Mass | 424.355 |
| Monoisotopic Mass | 424.12169 |
| SMILES | [H][C@]1([C@H](O)CO[C@H]2C=C(C(=O)O)O[C@]([H])([C@H](O)CO)C2)O[C@@](O)(C(=O)O)C[C@@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[Aad1122h-2a_2-6_8*OC^RCC^SC^RCO/6O/5OCCO/12=O/11=^XC$3]/1/ |
| InChI | InChI=1S/C16H24O13/c17-4-8(19)10-1-6(2-11(28-10)14(22)23)27-5-9(20)13-12(21)7(18)3-16(26,29-13)15(24)25/h2,6-10,12-13,17-21,26H,1,3-5H2,(H,22,23)(H,24,25)/t6-,7-,8-,9-,10+,12-,13-,16-/m1/s1 |
| InChIKey | UNHDIKYSAGHBNY-KWOHMGQJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-deoxy-4-epi-2,3-dehydro-Kdo-(4→8)-α-Kdo (CHEBI:61570) has functional parent 3-deoxy-α-D-manno-oct-2-ulopyranosonic acid (CHEBI:43577) |
| 5-deoxy-4-epi-2,3-dehydro-Kdo-(4→8)-α-Kdo (CHEBI:61570) is a carbohydrate acid (CHEBI:33720) |
| IUPAC Name |
|---|
| (6R)-6-[(1R)-2-({(2S,4R)-6-carboxy-2-[(1R)-1,2-dihydroxyethyl]-3,4-dihydro-2H-pyran-4-yl}oxy)-1-hydroxyethyl]-3-deoxy-β-L-erythro-hex-2-ulopyranosonic acid |
| Citations |
|---|