EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | CC1=CC[C@@H](C(C)C)CC1=O |
| InChI | InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,7,9H,5-6H2,1-3H3/t9-/m1/s1 |
| InChIKey | WPGPCDVQHXOMQP-SECBINFHSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5R)-5-isopropyl-2-methyl-2-cyclohexen-1-one (CHEBI:61551) has role allergen (CHEBI:50904) |
| (5R)-5-isopropyl-2-methyl-2-cyclohexen-1-one (CHEBI:61551) is a dihydrocarvones (CHEBI:61672) |
| IUPAC Name |
|---|
| (5R)-2-methyl-5-(1-methylethyl)cyclohex-2-en-1-one |
| Synonyms | Source |
|---|---|
| (-)-(5R)-1-isopropyl-2-methyl-2-cyclohexen-1-one | ChemIDplus |
| (R)-(-)-carvotanacetone | ChemIDplus |
| (R)-5-isopropyl-2-methyl-2-cyclohexen-1-one | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2205068 | Reaxys |
| Citations |
|---|