EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O10 |
| Net Charge | 0 |
| Average Mass | 326.298 |
| Monoisotopic Mass | 326.12130 |
| SMILES | C[C@@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]2O)[C@@H](O)[C@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/2,2,1/[a2112h-1b_1-5][a1221m-1a_1-5]/1-2/a2-b1 |
| InChI | InChI=1S/C12H22O10/c1-3-5(14)7(16)9(18)12(20-3)22-10-8(17)6(15)4(2-13)21-11(10)19/h3-19H,2H2,1H3/t3-,4+,5+,6-,7+,8-,9-,10+,11+,12-/m0/s1 |
| InChIKey | VSRVRBXGIRFARR-URMRTOKHSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-L-Fucp-(1→2)-β-D-Galp (CHEBI:61529) has role epitope (CHEBI:53000) |
| α-L-Fucp-(1→2)-β-D-Galp (CHEBI:61529) is a α-L-Fucp-(1→2)-D-Galp (CHEBI:62857) |
| Incoming Relation(s) |
| α-L-Fucp-(1→2)-β-D-Galp-(1→3)-D-Glc-OH (CHEBI:148578) has functional parent α-L-Fucp-(1→2)-β-D-Galp (CHEBI:61529) |
| α-L-Fucp-(1→2)-β-D-Galp-(1→3)-β-D-GlcpN (CHEBI:148785) has functional parent α-L-Fucp-(1→2)-β-D-Galp (CHEBI:61529) |
| α-L-Fucp-(1→2)-β-D-Galp-(1→4)-D-GalpNAc (CHEBI:147901) has functional parent α-L-Fucp-(1→2)-β-D-Galp (CHEBI:61529) |
| α-L-Fucp-(1→2)-β-D-Galp-(1→4)-D-Glu-OH (CHEBI:152991) has functional parent α-L-Fucp-(1→2)-β-D-Galp (CHEBI:61529) |
| α-L-fucosyl-(1→2)-β-D-galactosyl group (CHEBI:16124) is substituent group from α-L-Fucp-(1→2)-β-D-Galp (CHEBI:61529) |
| IUPAC Name |
|---|
| α-L-fucopyranosyl-(1→2)-β-D-galactopyranose |
| Synonyms | Source |
|---|---|
| 2-O-(6-deoxy-α-L-galactopyranosyl)-β-D-galactopyranose | ChEBI |
| 2-O-(6-deoxy-α-L-galactopyranosyl)-β-D-galactopyranose | IUPAC |
| 2-O-α-L-fucopyranosyl-β-D-galactopyranose | ChEBI |
| blood group antigen H | ChEBI |
| Fuca1-2Galb | ChEBI |
| Fucα-1→2Galβ | ChEBI |
| Citations |
|---|