EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N2O4 |
| Net Charge | 0 |
| Average Mass | 216.237 |
| Monoisotopic Mass | 216.11101 |
| SMILES | [H]C(=O)CCCNC(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H16N2O4/c10-7(9(14)15)3-4-8(13)11-5-1-2-6-12/h6-7H,1-5,10H2,(H,11,13)(H,14,15)/t7-/m0/s1 |
| InChIKey | JZNLEPLZUABCSQ-ZETCQYMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-glutamyl-γ-aminobutyraldehyde (CHEBI:61521) has role Escherichia coli metabolite (CHEBI:76971) |
| γ-glutamyl-γ-aminobutyraldehyde (CHEBI:61521) is a L-glutamine derivative (CHEBI:24317) |
| γ-glutamyl-γ-aminobutyraldehyde (CHEBI:61521) is a aldehyde (CHEBI:17478) |
| γ-glutamyl-γ-aminobutyraldehyde (CHEBI:61521) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| γ-glutamyl-γ-aminobutyraldehyde (CHEBI:61521) is tautomer of γ-glutamyl-γ-aminobutyraldehyde zwitterion (CHEBI:61508) |
| Incoming Relation(s) |
| γ-glutamyl-γ-aminobutyraldehyde zwitterion (CHEBI:61508) is tautomer of γ-glutamyl-γ-aminobutyraldehyde (CHEBI:61521) |
| IUPAC Name |
|---|
| N-(4-oxobutyl)-L-glutamine |
| Synonym | Source |
|---|---|
| γ-glutamyl-γ-aminobutanal | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C15700 | KEGG COMPOUND |