EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H50N8O17P3S |
| Net Charge | +1 |
| Average Mass | 895.736 |
| Monoisotopic Mass | 895.22220 |
| SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)CCC[N+](C)(C)C |
| InChI | InChI=1S/C28H49N8O17P3S/c1-28(2,23(40)26(41)31-9-8-18(37)30-10-12-57-19(38)7-6-11-36(3,4)5)14-50-56(47,48)53-55(45,46)49-13-17-22(52-54(42,43)44)21(39)27(51-17)35-16-34-20-24(29)32-15-33-25(20)35/h15-17,21-23,27,39-40H,6-14H2,1-5H3,(H7-,29,30,31,32,33,37,41,42,43,44,45,46,47,48)/p+1/t17-,21-,22-,23+,27-/m1/s1 |
| InChIKey | QAMRRBGWSPTAEJ-SVHODSNWSA-O |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-butyrobetainyl-CoA (CHEBI:61517) has functional parent 4-(trimethylammonio)butanoic acid (CHEBI:1941) |
| γ-butyrobetainyl-CoA (CHEBI:61517) has functional parent coenzyme A (CHEBI:15346) |
| γ-butyrobetainyl-CoA (CHEBI:61517) is a acyl-CoA (CHEBI:17984) |
| γ-butyrobetainyl-CoA (CHEBI:61517) is a quaternary ammonium ion (CHEBI:35267) |
| γ-butyrobetainyl-CoA (CHEBI:61517) is conjugate acid of γ-butyrobetainyl-CoA(3−) (CHEBI:61513) |
| Incoming Relation(s) |
| γ-butyrobetainyl-CoA(3−) (CHEBI:61513) is conjugate base of γ-butyrobetainyl-CoA (CHEBI:61517) |
| Synonyms | Source |
|---|---|
| 4-trimethylammoniobutanoyl-coenzyme A | ChEBI |
| γ-butyrobetainyl-coenzyme A | ChEBI |
| 4-trimethylammoniobutanoyl-CoA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| WO0024919 | Patent |
| Citations |
|---|