EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17N2O2S |
| Net Charge | -1 |
| Average Mass | 241.336 |
| Monoisotopic Mass | 241.10162 |
| SMILES | CCCC(C)C1(CC)C(=O)N=C([S-])NC1=O |
| InChI | InChI=1S/C11H18N2O2S/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16)/p-1 |
| InChIKey | IUJDSEJGGMCXSG-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiopental(1−) (CHEBI:61485) is a thiolate anion (CHEBI:50539) |
| thiopental(1−) (CHEBI:61485) is conjugate base of thiopental (CHEBI:102166) |
| Incoming Relation(s) |
| thiopental sodium (CHEBI:9561) has part thiopental(1−) (CHEBI:61485) |
| thiopental (CHEBI:102166) is conjugate acid of thiopental(1−) (CHEBI:61485) |
| IUPAC Name |
|---|
| 5-ethyl-4,6-dioxo-5-(pentan-2-yl)-1,4,5,6-tetrahydropyrimidine-2-thiolate |
| Synonyms | Source |
|---|---|
| thiopentone(1−) | ChEBI |
| pentothiobarbital(1−) | ChEBI |
| thiopentobarbitone(1−) | ChEBI |