EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22N2O16P2 |
| Net Charge | 0 |
| Average Mass | 536.276 |
| Monoisotopic Mass | 536.04446 |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@@H](CO)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C14H22N2O16P2/c17-3-5-8(19)11(22)13(30-5)31-34(26,27)32-33(24,25)28-4-6-9(20)10(21)12(29-6)16-2-1-7(18)15-14(16)23/h1-2,5-6,8-13,17,19-22H,3-4H2,(H,24,25)(H,26,27)(H,15,18,23)/t5-,6+,8-,9+,10+,11+,12+,13+/m0/s1 |
| InChIKey | QGNZSCRNMXQWNR-IAZOVDBXSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UDP-β-L-arabinofuranose (CHEBI:61460) is a UDP-sugar (CHEBI:17297) |
| UDP-β-L-arabinofuranose (CHEBI:61460) is conjugate acid of UDP-β-L-arabinofuranose(2−) (CHEBI:61463) |
| Incoming Relation(s) |
| UDP-β-L-arabinofuranose(2−) (CHEBI:61463) is conjugate base of UDP-β-L-arabinofuranose (CHEBI:61460) |
| IUPAC Name |
|---|
| uridine 5'-[3-(L-arabinofuranosyl) dihydrogen diphosphate] |
| Synonyms | Source |
|---|---|
| UDP-β-L-Araf | ChEBI |
| uridine 5'-diphospho-β-L-arabinofuranose | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-12511 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8884933 | Reaxys |
| Citations |
|---|