EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H36O11 |
| Net Charge | 0 |
| Average Mass | 692.717 |
| Monoisotopic Mass | 692.22576 |
| SMILES | CC(C)=CCc1c(-c2ccc(O)cc2O)oc2c([C@H]3C=C(C)C[C@@H](c4ccc(O)cc4O)[C@@H]3C(=O)c3ccc(O)cc3O)c(O)cc(O)c2c1=O |
| InChI | InChI=1S/C40H36O11/c1-18(2)4-8-26-38(50)36-33(48)17-32(47)35(40(36)51-39(26)25-11-7-22(43)16-31(25)46)28-13-19(3)12-27(23-9-5-20(41)14-29(23)44)34(28)37(49)24-10-6-21(42)15-30(24)45/h4-7,9-11,13-17,27-28,34,41-48H,8,12H2,1-3H3/t27-,28-,34-/m0/s1 |
| InChIKey | APPXYONGBIXGRO-AIQWNVMPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Morus alba (ncbitaxon:3498) | root (BTO:0001188) | PubMed (23806866) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kuwanone G (CHEBI:6146) has role anti-inflammatory agent (CHEBI:67079) |
| kuwanone G (CHEBI:6146) has role plant metabolite (CHEBI:76924) |
| kuwanone G (CHEBI:6146) is a resorcinols (CHEBI:33572) |
| kuwanone G (CHEBI:6146) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| 8-[(1R,2S,3S)-2-(2,4-dihydroxybenzoyl)-2',4'-dihydroxy-5-methyl[1,2,3,6-tetrahydro[1,1'-biphenyl]]-3-yl]-2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-3-(3-methylbut-2-en-1-yl)-4H-1-benzopyran-4-one |
| Synonym | Source |
|---|---|
| Kuwanone G | KEGG COMPOUND |
| Citations |
|---|